C21H20N4O4 — CID 55826568
(E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]prop-2-enamide (PubChem CID 55826568) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55826568 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cccc(-c3n[nH]c(C)n3)c2)cc2c1OCCO2 |
| InChI | InChI=1S/C21H20N4O4/c1-13-22-21(25-24-13)15-4-3-5-16(12-15)23-19(26)7-6-14-10-17(27-2)20-18(11-14)28-8-9-29-20/h3-7,10-12H,8-9H2,1-2H3,(H,23,26)(H,22,24,25)/b7-6+ |
| InChIKey | SWQRUNYJZBCVPA-VOTSOKGWSA-N |
| XLogP | 3.21 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|