C23H26N2O4 — CID 6234232
(E)-3-(3,4-dimethoxyphenyl)-N-[2-(piperidine-1-carbonyl)phenyl]prop-2-enamide (PubChem CID 6234232) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[2-(piperidine-1-carbonyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[2-(piperidine-1-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 6234232 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[2-(piperidine-1-carbonyl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccccc2C(=O)N2CCCCC2)cc1OC |
| InChI | InChI=1S/C23H26N2O4/c1-28-20-12-10-17(16-21(20)29-2)11-13-22(26)24-19-9-5-4-8-18(19)23(27)25-14-6-3-7-15-25/h4-5,8-13,16H,3,6-7,14-15H2,1-2H3,(H,24,26)/b13-11+ |
| InChIKey | QXRUQUPCPDTYSZ-ACCUITESSA-N |
| XLogP | 3.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|