C23H25N3O5S — CID 4933224
3-(3,4-dimethoxyphenyl)-N-[[2-(morpholine-4-carbonyl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 4933224) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[[2-(morpholine-4-carbonyl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[[2-(morpholine-4-carbonyl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 4933224 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[[2-(morpholine-4-carbonyl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)NC(=S)Nc2ccccc2C(=O)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C23H25N3O5S/c1-29-19-9-7-16(15-20(19)30-2)8-10-21(27)25-23(32)24-18-6-4-3-5-17(18)22(28)26-11-13-31-14-12-26/h3-10,15H,11-14H2,1-2H3,(H2,24,25,27,32) |
| InChIKey | MPKLCXDNOUKZHH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|