C20H20N2O5S — CID 93095175
methyl 2-[[(Z)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioylamino]benzoate (PubChem CID 93095175) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is methyl 2-[[(Z)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioylamino]benzoate.
| Compound Name | methyl 2-[[(Z)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 93095175 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | methyl 2-[[(Z)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=S)NC(=O)/C=C\c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H20N2O5S/c1-25-16-10-8-13(12-17(16)26-2)9-11-18(23)22-20(28)21-15-7-5-4-6-14(15)19(24)27-3/h4-12H,1-3H3,(H2,21,22,23,28)/b11-9- |
| InChIKey | KNKIMAAQFIOBGD-LUAWRHEFSA-N |
| XLogP | 3.02 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|