C18H16Cl2N2O3S — CID 6240014
(E)-N-[(2,3-dichlorophenyl)carbamothioyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 6240014) has the molecular formula C18H16Cl2N2O3S and a molecular weight of 411.31 g/mol. Its IUPAC name is (E)-N-[(2,3-dichlorophenyl)carbamothioyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(2,3-dichlorophenyl)carbamothioyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6240014 |
| Molecular Formula | C18H16Cl2N2O3S |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | (E)-N-[(2,3-dichlorophenyl)carbamothioyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(=S)Nc2cccc(Cl)c2Cl)cc1OC |
| InChI | InChI=1S/C18H16Cl2N2O3S/c1-24-14-8-6-11(10-15(14)25-2)7-9-16(23)22-18(26)21-13-5-3-4-12(19)17(13)20/h3-10H,1-2H3,(H2,21,22,23,26)/b9-7+ |
| InChIKey | HTDUJUFZDJSXRT-VQHVLOKHSA-N |
| XLogP | 4.54 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|