C18H16ClNO5 — CID 77378923
2-chloro-6-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]benzoic acid (PubChem CID 77378923) has the molecular formula C18H16ClNO5 and a molecular weight of 361.78 g/mol. Its IUPAC name is 2-chloro-6-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]benzoic acid.
| Compound Name | 2-chloro-6-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]benzoic acid |
|---|---|
| PubChem CID | 77378923 |
| Molecular Formula | C18H16ClNO5 |
| Molecular Weight | 361.78 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-chloro-6-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]benzoic acid |
| SMILES | COc1ccc(C=CC(=O)Nc2cccc(Cl)c2C(=O)O)cc1OC |
| InChI | InChI=1S/C18H16ClNO5/c1-24-14-8-6-11(10-15(14)25-2)7-9-16(21)20-13-5-3-4-12(19)17(13)18(22)23/h3-10H,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | WAKKOPHSDPURKJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.78 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|