C25H23Cl2NO5 — CID 4132324
3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(2,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 4132324) has the molecular formula C25H23Cl2NO5 and a molecular weight of 488.37 g/mol. Its IUPAC name is 3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(2,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | 3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(2,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4132324 |
| Molecular Formula | C25H23Cl2NO5 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(2,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(OC)c(NC(=O)C=Cc2ccc(OCc3c(Cl)cccc3Cl)c(OC)c2)c1 |
| InChI | InChI=1S/C25H23Cl2NO5/c1-30-17-9-11-22(31-2)21(14-17)28-25(29)12-8-16-7-10-23(24(13-16)32-3)33-15-18-19(26)5-4-6-20(18)27/h4-14H,15H2,1-3H3,(H,28,29) |
| InChIKey | OOHVISNLIYMHKT-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|