C24H20Cl3NO3 — CID 4189478
N-(3-chloro-4-methylphenyl)-3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enamide (PubChem CID 4189478) has the molecular formula C24H20Cl3NO3 and a molecular weight of 476.79 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4189478 |
| Molecular Formula | C24H20Cl3NO3 |
| Molecular Weight | 476.79 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2ccc(C)c(Cl)c2)ccc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H20Cl3NO3/c1-15-6-9-17(13-21(15)27)28-24(29)11-8-16-7-10-22(23(12-16)30-2)31-14-18-19(25)4-3-5-20(18)26/h3-13H,14H2,1-2H3,(H,28,29) |
| InChIKey | ASESFPNZXLRDRL-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.79 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|