C22H20Cl2N2O3S — CID 4518402
3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 4518402) has the molecular formula C22H20Cl2N2O3S and a molecular weight of 463.39 g/mol. Its IUPAC name is 3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | 3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4518402 |
| Molecular Formula | C22H20Cl2N2O3S |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2nc(C)c(C)s2)ccc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C22H20Cl2N2O3S/c1-13-14(2)30-22(25-13)26-21(27)10-8-15-7-9-19(20(11-15)28-3)29-12-16-17(23)5-4-6-18(16)24/h4-11H,12H2,1-3H3,(H,25,26,27) |
| InChIKey | IXVXBAQZKALZIV-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|