C24H20Cl2N2O5 — CID 6005799
(E)-3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4-methyl-2-nitrophenyl)prop-2-enamide (PubChem CID 6005799) has the molecular formula C24H20Cl2N2O5 and a molecular weight of 487.34 g/mol. Its IUPAC name is (E)-3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4-methyl-2-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4-methyl-2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6005799 |
| Molecular Formula | C24H20Cl2N2O5 |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | (E)-3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4-methyl-2-nitrophenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc(C)cc2[N+](=O)[O-])ccc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H20Cl2N2O5/c1-15-6-9-20(21(12-15)28(30)31)27-24(29)11-8-16-7-10-22(23(13-16)32-2)33-14-17-18(25)4-3-5-19(17)26/h3-13H,14H2,1-2H3,(H,27,29)/b11-8+ |
| InChIKey | YWYSZPWRARUTFR-DHZHZOJOSA-N |
| XLogP | 6.45 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|