C25H21Cl2NO5 — CID 4132327
3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide (PubChem CID 4132327) has the molecular formula C25H21Cl2NO5 and a molecular weight of 486.35 g/mol. Its IUPAC name is 3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide.
| Compound Name | 3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4132327 |
| Molecular Formula | C25H21Cl2NO5 |
| Molecular Weight | 486.35 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2ccc3c(c2)OCCO3)ccc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C25H21Cl2NO5/c1-30-23-13-16(5-8-21(23)33-15-18-19(26)3-2-4-20(18)27)6-10-25(29)28-17-7-9-22-24(14-17)32-12-11-31-22/h2-10,13-14H,11-12,15H2,1H3,(H,28,29) |
| InChIKey | WFPLJGJSXDNOTD-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.35 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|