C29H29Cl2NO5 — CID 19191864
pentyl 4-[[(E)-3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]benzoate (PubChem CID 19191864) has the molecular formula C29H29Cl2NO5 and a molecular weight of 542.46 g/mol. Its IUPAC name is pentyl 4-[[(E)-3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]benzoate.
| Compound Name | pentyl 4-[[(E)-3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 19191864 |
| Molecular Formula | C29H29Cl2NO5 |
| Molecular Weight | 542.46 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | pentyl 4-[[(E)-3-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]benzoate |
| SMILES | CCCCCOC(=O)c1ccc(NC(=O)/C=C/c2ccc(OCc3c(Cl)cccc3Cl)c(OC)c2)cc1 |
| InChI | InChI=1S/C29H29Cl2NO5/c1-3-4-5-17-36-29(34)21-11-13-22(14-12-21)32-28(33)16-10-20-9-15-26(27(18-20)35-2)37-19-23-24(30)7-6-8-25(23)31/h6-16,18H,3-5,17,19H2,1-2H3,(H,32,33)/b16-10+ |
| InChIKey | FENNXTQYVSZMOV-MHWRWJLKSA-N |
| XLogP | 7.58 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.46 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|