C27H35NO6 — CID 19171941
2-ethoxyethyl 4-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 19171941) has the molecular formula C27H35NO6 and a molecular weight of 469.58 g/mol. Its IUPAC name is 2-ethoxyethyl 4-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | 2-ethoxyethyl 4-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 19171941 |
| Molecular Formula | C27H35NO6 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 2-ethoxyethyl 4-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | CCCCCCOc1ccc(/C=C/C(=O)Nc2ccc(C(=O)OCCOCC)cc2)cc1OC |
| InChI | InChI=1S/C27H35NO6/c1-4-6-7-8-17-33-24-15-9-21(20-25(24)31-3)10-16-26(29)28-23-13-11-22(12-14-23)27(30)34-19-18-32-5-2/h9-16,20H,4-8,17-19H2,1-3H3,(H,28,29)/b16-10+ |
| InChIKey | HILFYCYIWCMMMA-MHWRWJLKSA-N |
| XLogP | 5.50 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|