C27H35NO5 — CID 19236800
pentyl 4-[[(E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 19236800) has the molecular formula C27H35NO5 and a molecular weight of 453.58 g/mol. Its IUPAC name is pentyl 4-[[(E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | pentyl 4-[[(E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 19236800 |
| Molecular Formula | C27H35NO5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | pentyl 4-[[(E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | CCCCCOC(=O)c1ccc(NC(=O)/C=C/c2ccc(OCCCC)c(OCC)c2)cc1 |
| InChI | InChI=1S/C27H35NO5/c1-4-7-9-19-33-27(30)22-12-14-23(15-13-22)28-26(29)17-11-21-10-16-24(32-18-8-5-2)25(20-21)31-6-3/h10-17,20H,4-9,18-19H2,1-3H3,(H,28,29)/b17-11+ |
| InChIKey | OIOQWAWDKSSNQG-GZTJUZNOSA-N |
| XLogP | 6.26 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|