C22H27NO5 — CID 100534622
butyl 4-[(3,4-diethoxybenzoyl)amino]benzoate (PubChem CID 100534622) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is butyl 4-[(3,4-diethoxybenzoyl)amino]benzoate.
| Compound Name | butyl 4-[(3,4-diethoxybenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 100534622 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | butyl 4-[(3,4-diethoxybenzoyl)amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2ccc(OCC)c(OCC)c2)cc1 |
| InChI | InChI=1S/C22H27NO5/c1-4-7-14-28-22(25)16-8-11-18(12-9-16)23-21(24)17-10-13-19(26-5-2)20(15-17)27-6-3/h8-13,15H,4-7,14H2,1-3H3,(H,23,24) |
| InChIKey | OSXCQADKKFQQFI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|