C30H33NO5 — CID 3492444
hexyl 4-[3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoylamino]benzoate (PubChem CID 3492444) has the molecular formula C30H33NO5 and a molecular weight of 487.60 g/mol. Its IUPAC name is hexyl 4-[3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoylamino]benzoate.
| Compound Name | hexyl 4-[3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoylamino]benzoate |
|---|---|
| PubChem CID | 3492444 |
| Molecular Formula | C30H33NO5 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | hexyl 4-[3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoylamino]benzoate |
| SMILES | CCCCCCOC(=O)c1ccc(NC(=O)C=Cc2ccc(OCc3ccccc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C30H33NO5/c1-3-4-5-9-20-35-30(33)25-14-16-26(17-15-25)31-29(32)19-13-23-12-18-27(28(21-23)34-2)36-22-24-10-7-6-8-11-24/h6-8,10-19,21H,3-5,9,20,22H2,1-2H3,(H,31,32) |
| InChIKey | UHMZYXWSOJTWSZ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|