C23H27NO5 — CID 67889825
2-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]benzoic acid (PubChem CID 67889825) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 2-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 67889825 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 2-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]benzoic acid |
| SMILES | CCCCCCOc1ccc(/C=C/C(=O)Nc2ccccc2C(=O)O)cc1OC |
| InChI | InChI=1S/C23H27NO5/c1-3-4-5-8-15-29-20-13-11-17(16-21(20)28-2)12-14-22(25)24-19-10-7-6-9-18(19)23(26)27/h6-7,9-14,16H,3-5,8,15H2,1-2H3,(H,24,25)(H,26,27)/b14-12+ |
| InChIKey | DEAMBYYXGPJNTH-WYMLVPIESA-N |
| XLogP | 5.00 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|