C24H28N4O5 — CID 143602565
ethane;2-[[(E)-3-[4-[(1-ethyltriazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]benzoic acid (PubChem CID 143602565) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is ethane;2-[[(E)-3-[4-[(1-ethyltriazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]benzoic acid.
| Compound Name | ethane;2-[[(E)-3-[4-[(1-ethyltriazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 143602565 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | ethane;2-[[(E)-3-[4-[(1-ethyltriazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]benzoic acid |
| SMILES | CC.CCn1cc(COc2ccc(/C=C/C(=O)Nc3ccccc3C(=O)O)cc2OC)nn1 |
| InChI | InChI=1S/C22H22N4O5.C2H6/c1-3-26-13-16(24-25-26)14-31-19-10-8-15(12-20(19)30-2)9-11-21(27)23-18-7-5-4-6-17(18)22(28)29;1-2/h4-13H,3,14H2,1-2H3,(H,23,27)(H,28,29);1-2H3/b11-9+; |
| InChIKey | KBTWPDVHJXDOKL-LBEJWNQZSA-N |
| XLogP | 4.26 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|