C23H22N2O6 — CID 135290061
2-[[(E)-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]benzoic acid (PubChem CID 135290061) has the molecular formula C23H22N2O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is 2-[[(E)-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]benzoic acid.
| Compound Name | 2-[[(E)-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 135290061 |
| Molecular Formula | C23H22N2O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-[[(E)-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]benzoic acid |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccccc2C(=O)O)ccc1OCc1c(C)noc1C |
| InChI | InChI=1S/C23H22N2O6/c1-14-18(15(2)31-25-14)13-30-20-10-8-16(12-21(20)29-3)9-11-22(26)24-19-7-5-4-6-17(19)23(27)28/h4-12H,13H2,1-3H3,(H,24,26)(H,27,28)/b11-9+ |
| InChIKey | WHPCDYUQVZBKSO-PKNBQFBNSA-N |
| XLogP | 4.23 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|