C24H29NO6 — CID 134468923
2-[[(E)-3-[4-(4-hydroxy-2,4-dimethylpentan-2-yl)oxy-3-methoxyphenyl]prop-2-enoyl]amino]benzoic acid (PubChem CID 134468923) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-[[(E)-3-[4-(4-hydroxy-2,4-dimethylpentan-2-yl)oxy-3-methoxyphenyl]prop-2-enoyl]amino]benzoic acid.
| Compound Name | 2-[[(E)-3-[4-(4-hydroxy-2,4-dimethylpentan-2-yl)oxy-3-methoxyphenyl]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 134468923 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 2-[[(E)-3-[4-(4-hydroxy-2,4-dimethylpentan-2-yl)oxy-3-methoxyphenyl]prop-2-enoyl]amino]benzoic acid |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccccc2C(=O)O)ccc1OC(C)(C)CC(C)(C)O |
| InChI | InChI=1S/C24H29NO6/c1-23(2,29)15-24(3,4)31-19-12-10-16(14-20(19)30-5)11-13-21(26)25-18-9-7-6-8-17(18)22(27)28/h6-14,29H,15H2,1-5H3,(H,25,26)(H,27,28)/b13-11+ |
| InChIKey | GUXYNGONUWDPEX-ACCUITESSA-N |
| XLogP | 4.36 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|