C21H21NO5 — CID 67889721
2-[[(E)-3-(4-cyclobutyloxy-3-methoxyphenyl)prop-2-enoyl]amino]benzoic acid (PubChem CID 67889721) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-[[(E)-3-(4-cyclobutyloxy-3-methoxyphenyl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 2-[[(E)-3-(4-cyclobutyloxy-3-methoxyphenyl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 67889721 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-[[(E)-3-(4-cyclobutyloxy-3-methoxyphenyl)prop-2-enoyl]amino]benzoic acid |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccccc2C(=O)O)ccc1OC1CCC1 |
| InChI | InChI=1S/C21H21NO5/c1-26-19-13-14(9-11-18(19)27-15-5-4-6-15)10-12-20(23)22-17-8-3-2-7-16(17)21(24)25/h2-3,7-13,15H,4-6H2,1H3,(H,22,23)(H,24,25)/b12-10+ |
| InChIKey | ARSQNBRPIUXIAT-ZRDIBKRKSA-N |
| XLogP | 3.98 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|