C22H26N2O5 — CID 54692122
5-[(E)-3-(2-carboxyanilino)-3-oxoprop-1-enyl]-2-methoxyphenolate;piperidin-1-ium (PubChem CID 54692122) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 5-[(E)-3-(2-carboxyanilino)-3-oxoprop-1-enyl]-2-methoxyphenolate;piperidin-1-ium.
| Compound Name | 5-[(E)-3-(2-carboxyanilino)-3-oxoprop-1-enyl]-2-methoxyphenolate;piperidin-1-ium |
|---|---|
| PubChem CID | 54692122 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 5-[(E)-3-(2-carboxyanilino)-3-oxoprop-1-enyl]-2-methoxyphenolate;piperidin-1-ium |
| SMILES | C1CC[NH2+]CC1.COc1ccc(/C=C/C(=O)Nc2ccccc2C(=O)O)cc1[O-] |
| InChI | InChI=1S/C17H15NO5.C5H11N/c1-23-15-8-6-11(10-14(15)19)7-9-16(20)18-13-5-3-2-4-12(13)17(21)22;1-2-4-6-5-3-1/h2-10,19H,1H3,(H,18,20)(H,21,22);6H,1-5H2/b9-7+; |
| InChIKey | OPNPUWKEHDLRDT-BXTVWIJMSA-N |
| XLogP | 1.85 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|