C22H22N2O4 — CID 135290049
2-[[(E)-3-[3-methoxy-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid (PubChem CID 135290049) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-[[(E)-3-[3-methoxy-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid.
| Compound Name | 2-[[(E)-3-[3-methoxy-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 135290049 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2-[[(E)-3-[3-methoxy-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccccc2C(=O)O)ccc1C1=CCNCC1 |
| InChI | InChI=1S/C22H22N2O4/c1-28-20-14-15(6-8-17(20)16-10-12-23-13-11-16)7-9-21(25)24-19-5-3-2-4-18(19)22(26)27/h2-10,14,23H,11-13H2,1H3,(H,24,25)(H,26,27)/b9-7+ |
| InChIKey | VGRNIIKNTMNUQN-VQHVLOKHSA-N |
| XLogP | 3.42 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|