C25H22N2O8S — CID 71760933
2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]benzoic acid;1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 71760933) has the molecular formula C25H22N2O8S and a molecular weight of 510.52 g/mol. Its IUPAC name is 2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]benzoic acid;1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]benzoic acid;1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 71760933 |
| Molecular Formula | C25H22N2O8S |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]benzoic acid;1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccccc2C(=O)O)cc1OC.O=C1NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C18H17NO5.C7H5NO3S/c1-23-15-9-7-12(11-16(15)24-2)8-10-17(20)19-14-6-4-3-5-13(14)18(21)22;9-7-5-3-1-2-4-6(5)12(10,11)8-7/h3-11H,1-2H3,(H,19,20)(H,21,22);1-4H,(H,8,9)/b10-8+; |
| InChIKey | SZXHRDGYVRJHMB-VRTOBVRTSA-N |
| XLogP | 3.17 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|