C19H17NO3 — CID 67531419
2-[3-(2,3-dihydro-1H-inden-5-yl)prop-2-enoylamino]benzoic acid (PubChem CID 67531419) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[3-(2,3-dihydro-1H-inden-5-yl)prop-2-enoylamino]benzoic acid.
| Compound Name | 2-[3-(2,3-dihydro-1H-inden-5-yl)prop-2-enoylamino]benzoic acid |
|---|---|
| PubChem CID | 67531419 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-[3-(2,3-dihydro-1H-inden-5-yl)prop-2-enoylamino]benzoic acid |
| SMILES | O=C(C=Cc1ccc2c(c1)CCC2)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C19H17NO3/c21-18(20-17-7-2-1-6-16(17)19(22)23)11-9-13-8-10-14-4-3-5-15(14)12-13/h1-2,6-12H,3-5H2,(H,20,21)(H,22,23) |
| InChIKey | VWLQLOVDCXYDJY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|