C25H21NO3 — CID 142690906
2-[[(E)-3-[4-(2,3-dihydro-1H-inden-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid (PubChem CID 142690906) has the molecular formula C25H21NO3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-[[(E)-3-[4-(2,3-dihydro-1H-inden-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid.
| Compound Name | 2-[[(E)-3-[4-(2,3-dihydro-1H-inden-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 142690906 |
| Molecular Formula | C25H21NO3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-[[(E)-3-[4-(2,3-dihydro-1H-inden-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid |
| SMILES | O=C(/C=C/c1ccc(-c2cccc3c2CCC3)cc1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C25H21NO3/c27-24(26-23-10-2-1-7-22(23)25(28)29)16-13-17-11-14-19(15-12-17)21-9-4-6-18-5-3-8-20(18)21/h1-2,4,6-7,9-16H,3,5,8H2,(H,26,27)(H,28,29)/b16-13+ |
| InChIKey | ZIRHCZJSVISYEF-DTQAZKPQSA-N |
| XLogP | 5.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|