About 2-[[(E)-3-[4-(2,3-dihydro-1H-inden-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid
2-[[(E)-3-[4-(2,3-dihydro-1H-inden-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid (PubChem CID 142690906) has the molecular formula C25H21NO3
and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-[[(E)-3-[4-(2,3-dihydro-1H-inden-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid.
Molecular Properties
| Compound Name | 2-[[(E)-3-[4-(2,3-dihydro-1H-inden-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid |
| PubChem CID | 142690906 |
| Molecular Formula | C25H21NO3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-[[(E)-3-[4-(2,3-dihydro-1H-inden-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid |
| SMILES | O=C(/C=C/c1ccc(-c2cccc3c2CCC3)cc1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C25H21NO3/c27-24(26-23-10-2-1-7-22(23)25(28)29)16-13-17-11-14-19(15-12-17)21-9-4-6-18-5-3-8-20(18)21/h1-2,4,6-7,9-16H,3,5,8H2,(H,26,27)(H,28,29)/b16-13+ |
| InChIKey | ZIRHCZJSVISYEF-DTQAZKPQSA-N |
| XLogP | 5.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(E)-3-[4-(2,3-dihydro-1H-inden-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(E)-3-[4-(2,3-dihydro-1H-inden-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid?
The IUPAC name of 2-[[(E)-3-[4-(2,3-dihydro-1H-inden-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid (CID 142690906) is 2-[[(E)-3-[4-(2,3-dihydro-1H-inden-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid.
What is the SMILES notation for 2-[[(E)-3-[4-(2,3-dihydro-1H-inden-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid?
The canonical SMILES for 2-[[(E)-3-[4-(2,3-dihydro-1H-inden-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid is O=C(/C=C/c1ccc(-c2cccc3c2CCC3)cc1)Nc1ccccc1C(=O)O.
What is the InChIKey of 2-[[(E)-3-[4-(2,3-dihydro-1H-inden-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid?
The InChIKey is ZIRHCZJSVISYEF-DTQAZKPQSA-N. The full InChI is InChI=1S/C25H21NO3/c27-24(26-23-10-2-1-7-22(23)25(28)29)16-13-17-11-14-19(15-12-17)21-9-4-6-18-5-3-8-20(18)21/h1-2,4,6-7,9-16H,3,5,8H2,(H,26,27)(H,28,29)/b16-13+.
What are the key properties of 2-[[(E)-3-[4-(2,3-dihydro-1H-inden-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid?
2-[[(E)-3-[4-(2,3-dihydro-1H-inden-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid has a molecular weight of 383.45 g/mol, XLogP of 5.19, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(E)-3-[4-(2,3-dihydro-1H-inden-4-yl)phenyl]prop-2-enoyl]amino]benzoic acid is sourced from PubChem (CID 142690906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).