C23H27NO — CID 76617104
3-(4-tert-butylphenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)prop-2-enamide (PubChem CID 76617104) has the molecular formula C23H27NO and a molecular weight of 333.48 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)prop-2-enamide.
| Compound Name | 3-(4-tert-butylphenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 76617104 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)prop-2-enamide |
| SMILES | CC(C)(C)c1ccc(C=CC(=O)Nc2cccc3c2CCCC3)cc1 |
| InChI | InChI=1S/C23H27NO/c1-23(2,3)19-14-11-17(12-15-19)13-16-22(25)24-21-10-6-8-18-7-4-5-9-20(18)21/h6,8,10-16H,4-5,7,9H2,1-3H3,(H,24,25) |
| InChIKey | MJOYBOTXXVVNEP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|