C20H22ClNO — CID 4161099
3-(4-tert-butylphenyl)-N-(5-chloro-2-methylphenyl)prop-2-enamide (PubChem CID 4161099) has the molecular formula C20H22ClNO and a molecular weight of 327.86 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N-(5-chloro-2-methylphenyl)prop-2-enamide.
| Compound Name | 3-(4-tert-butylphenyl)-N-(5-chloro-2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4161099 |
| Molecular Formula | C20H22ClNO |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N-(5-chloro-2-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C=Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H22ClNO/c1-14-5-11-17(21)13-18(14)22-19(23)12-8-15-6-9-16(10-7-15)20(2,3)4/h5-13H,1-4H3,(H,22,23) |
| InChIKey | RVUJNBBLAWDSBI-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|