C11H10ClNO3 — CID 710513
(E)-4-(5-chloro-2-methylanilino)-4-oxobut-2-enoic acid (PubChem CID 710513) has the molecular formula C11H10ClNO3 and a molecular weight of 239.66 g/mol. Its IUPAC name is (E)-4-(5-chloro-2-methylanilino)-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(5-chloro-2-methylanilino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 710513 |
| Molecular Formula | C11H10ClNO3 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | (E)-4-(5-chloro-2-methylanilino)-4-oxobut-2-enoic acid |
| SMILES | Cc1ccc(Cl)cc1NC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C11H10ClNO3/c1-7-2-3-8(12)6-9(7)13-10(14)4-5-11(15)16/h2-6H,1H3,(H,13,14)(H,15,16)/b5-4+ |
| InChIKey | KFLFGXYJSLVOCF-SNAWJCMRSA-N |
| XLogP | 2.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|