C13H14ClNO — CID 9403286
(2E,4E)-N-(5-chloro-2-methylphenyl)hexa-2,4-dienamide (PubChem CID 9403286) has the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. Its IUPAC name is (2E,4E)-N-(5-chloro-2-methylphenyl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(5-chloro-2-methylphenyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 9403286 |
| Molecular Formula | C13H14ClNO |
| Molecular Weight | 235.71 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | (2E,4E)-N-(5-chloro-2-methylphenyl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1cc(Cl)ccc1C |
| InChI | InChI=1S/C13H14ClNO/c1-3-4-5-6-13(16)15-12-9-11(14)8-7-10(12)2/h3-9H,1-2H3,(H,15,16)/b4-3+,6-5+ |
| InChIKey | PAEZDRPIAOAPEG-VNKDHWASSA-N |
| XLogP | 3.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.71 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|