C14H17ClN2O — CID 78844634
(4E)-N-[5-chloro-2-(dimethylamino)phenyl]hexa-2,4-dienamide (PubChem CID 78844634) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is (4E)-N-[5-chloro-2-(dimethylamino)phenyl]hexa-2,4-dienamide.
| Compound Name | (4E)-N-[5-chloro-2-(dimethylamino)phenyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 78844634 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (4E)-N-[5-chloro-2-(dimethylamino)phenyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=CC(=O)Nc1cc(Cl)ccc1N(C)C |
| InChI | InChI=1S/C14H17ClN2O/c1-4-5-6-7-14(18)16-12-10-11(15)8-9-13(12)17(2)3/h4-10H,1-3H3,(H,16,18)/b5-4+,7-6? |
| InChIKey | GEHKMCHEPFQUGA-DBYMJTHYSA-N |
| XLogP | 3.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|