C19H19ClFNO — CID 3425508
3-(4-tert-butylphenyl)-N-(4-chloro-2-fluorophenyl)prop-2-enamide (PubChem CID 3425508) has the molecular formula C19H19ClFNO and a molecular weight of 331.82 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N-(4-chloro-2-fluorophenyl)prop-2-enamide.
| Compound Name | 3-(4-tert-butylphenyl)-N-(4-chloro-2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3425508 |
| Molecular Formula | C19H19ClFNO |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N-(4-chloro-2-fluorophenyl)prop-2-enamide |
| SMILES | CC(C)(C)c1ccc(C=CC(=O)Nc2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C19H19ClFNO/c1-19(2,3)14-7-4-13(5-8-14)6-11-18(23)22-17-10-9-15(20)12-16(17)21/h4-12H,1-3H3,(H,22,23) |
| InChIKey | MQUQUPLAIUEPTH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|