C19H19FN2O3 — CID 844305
(E)-3-(4-tert-butylphenyl)-N-(4-fluoro-3-nitrophenyl)prop-2-enamide (PubChem CID 844305) has the molecular formula C19H19FN2O3 and a molecular weight of 342.37 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-N-(4-fluoro-3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-3-(4-tert-butylphenyl)-N-(4-fluoro-3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 844305 |
| Molecular Formula | C19H19FN2O3 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-N-(4-fluoro-3-nitrophenyl)prop-2-enamide |
| SMILES | CC(C)(C)c1ccc(/C=C/C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H19FN2O3/c1-19(2,3)14-7-4-13(5-8-14)6-11-18(23)21-15-9-10-16(20)17(12-15)22(24)25/h4-12H,1-3H3,(H,21,23)/b11-6+ |
| InChIKey | ZQPSVSUYGWVRNY-IZZDOVSWSA-N |
| XLogP | 4.68 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|