C38H40N4O7 — CID 161085008
(E)-3-(4-tert-butylphenyl)-N-(4-hydroxy-3-nitrophenyl)prop-2-enamide;(E)-3-(4-tert-butylphenyl)-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 161085008) has the molecular formula C38H40N4O7 and a molecular weight of 664.76 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-N-(4-hydroxy-3-nitrophenyl)prop-2-enamide;(E)-3-(4-tert-butylphenyl)-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-3-(4-tert-butylphenyl)-N-(4-hydroxy-3-nitrophenyl)prop-2-enamide;(E)-3-(4-tert-butylphenyl)-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 161085008 |
| Molecular Formula | C38H40N4O7 |
| Molecular Weight | 664.76 g/mol |
| Exact Mass | 664.29 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-N-(4-hydroxy-3-nitrophenyl)prop-2-enamide;(E)-3-(4-tert-butylphenyl)-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | CC(C)(C)c1ccc(/C=C/C(=O)Nc2ccc(O)c([N+](=O)[O-])c2)cc1.CC(C)(C)c1ccc(/C=C/C(=O)Nc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H20N2O4.C19H20N2O3/c1-19(2,3)14-7-4-13(5-8-14)6-11-18(23)20-15-9-10-17(22)16(12-15)21(24)25;1-19(2,3)15-10-7-14(8-11-15)9-12-18(22)20-16-5-4-6-17(13-16)21(23)24/h4-12,22H,1-3H3,(H,20,23);4-13H,1-3H3,(H,20,22)/b11-6+;12-9+ |
| InChIKey | UGJSYFUHELWYIY-DAODDXKCSA-N |
| XLogP | 8.79 |
| TPSA | 164.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.76 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|