C12H11FN2O3 — CID 26696924
(2E,4E)-N-(4-fluoro-3-nitrophenyl)hexa-2,4-dienamide (PubChem CID 26696924) has the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. Its IUPAC name is (2E,4E)-N-(4-fluoro-3-nitrophenyl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(4-fluoro-3-nitrophenyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 26696924 |
| Molecular Formula | C12H11FN2O3 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (2E,4E)-N-(4-fluoro-3-nitrophenyl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H11FN2O3/c1-2-3-4-5-12(16)14-9-6-7-10(13)11(8-9)15(17)18/h2-8H,1H3,(H,14,16)/b3-2+,5-4+ |
| InChIKey | LPYJAZFNZWHWEK-MQQKCMAXSA-N |
| XLogP | 2.80 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|