C12H12N2O3 — CID 11436192
(2E,4E)-N-(2-nitrophenyl)hexa-2,4-dienamide (PubChem CID 11436192) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is (2E,4E)-N-(2-nitrophenyl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-nitrophenyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 11436192 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | (2E,4E)-N-(2-nitrophenyl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N2O3/c1-2-3-4-9-12(15)13-10-7-5-6-8-11(10)14(16)17/h2-9H,1H3,(H,13,15)/b3-2+,9-4+ |
| InChIKey | OQNFVMRNJDMRDI-DSXPNFDZSA-N |
| XLogP | 2.67 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|