C15H10Cl2N2O3 — CID 92909271
(Z)-3-(2,6-dichlorophenyl)-N-(2-nitrophenyl)prop-2-enamide (PubChem CID 92909271) has the molecular formula C15H10Cl2N2O3 and a molecular weight of 337.16 g/mol. Its IUPAC name is (Z)-3-(2,6-dichlorophenyl)-N-(2-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-3-(2,6-dichlorophenyl)-N-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 92909271 |
| Molecular Formula | C15H10Cl2N2O3 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | (Z)-3-(2,6-dichlorophenyl)-N-(2-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C\c1c(Cl)cccc1Cl)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H10Cl2N2O3/c16-11-4-3-5-12(17)10(11)8-9-15(20)18-13-6-1-2-7-14(13)19(21)22/h1-9H,(H,18,20)/b9-8- |
| InChIKey | UPHYAXZICGIZRR-HJWRWDBZSA-N |
| XLogP | 4.55 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|