C16H10FN3O7 — CID 9207805
(E)-N-(4-fluoro-3-nitrophenyl)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide (PubChem CID 9207805) has the molecular formula C16H10FN3O7 and a molecular weight of 375.27 g/mol. Its IUPAC name is (E)-N-(4-fluoro-3-nitrophenyl)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-(4-fluoro-3-nitrophenyl)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9207805 |
| Molecular Formula | C16H10FN3O7 |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | (E)-N-(4-fluoro-3-nitrophenyl)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc2c(cc1[N+](=O)[O-])OCO2)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H10FN3O7/c17-11-3-2-10(6-13(11)20(24)25)18-16(21)4-1-9-5-14-15(27-8-26-14)7-12(9)19(22)23/h1-7H,8H2,(H,18,21)/b4-1+ |
| InChIKey | KBROYOPHLUZFKQ-DAFODLJHSA-N |
| XLogP | 3.02 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|