C17H12ClN3O6 — CID 9206851
4-chloro-N'-[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]benzohydrazide (PubChem CID 9206851) has the molecular formula C17H12ClN3O6 and a molecular weight of 389.75 g/mol. Its IUPAC name is 4-chloro-N'-[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 9206851 |
| Molecular Formula | C17H12ClN3O6 |
| Molecular Weight | 389.75 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 4-chloro-N'-[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]benzohydrazide |
| SMILES | O=C(/C=C/c1cc2c(cc1[N+](=O)[O-])OCO2)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H12ClN3O6/c18-12-4-1-10(2-5-12)17(23)20-19-16(22)6-3-11-7-14-15(27-9-26-14)8-13(11)21(24)25/h1-8H,9H2,(H,19,22)(H,20,23)/b6-3+ |
| InChIKey | CZDJKXOCQQTSIY-ZZXKWVIFSA-N |
| XLogP | 2.45 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.75 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|