C16H18N4O5S — CID 9147520
1-cyclopentyl-3-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]thiourea (PubChem CID 9147520) has the molecular formula C16H18N4O5S and a molecular weight of 378.41 g/mol. Its IUPAC name is 1-cyclopentyl-3-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]thiourea.
| Compound Name | 1-cyclopentyl-3-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]thiourea |
|---|---|
| PubChem CID | 9147520 |
| Molecular Formula | C16H18N4O5S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 1-cyclopentyl-3-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]thiourea |
| SMILES | O=C(/C=C/c1cc2c(cc1[N+](=O)[O-])OCO2)NNC(=S)NC1CCCC1 |
| InChI | InChI=1S/C16H18N4O5S/c21-15(18-19-16(26)17-11-3-1-2-4-11)6-5-10-7-13-14(25-9-24-13)8-12(10)20(22)23/h5-8,11H,1-4,9H2,(H,18,21)(H2,17,19,26)/b6-5+ |
| InChIKey | JVCNVEHQIAAOLL-AATRIKPKSA-N |
| XLogP | 1.77 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|