C20H16N2O9 — CID 27667592
dimethyl 5-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]benzene-1,3-dicarboxylate (PubChem CID 27667592) has the molecular formula C20H16N2O9 and a molecular weight of 428.35 g/mol. Its IUPAC name is dimethyl 5-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 27667592 |
| Molecular Formula | C20H16N2O9 |
| Molecular Weight | 428.35 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | dimethyl 5-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)/C=C/c2cc3c(cc2[N+](=O)[O-])OCO3)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C20H16N2O9/c1-28-19(24)12-5-13(20(25)29-2)7-14(6-12)21-18(23)4-3-11-8-16-17(31-10-30-16)9-15(11)22(26)27/h3-9H,10H2,1-2H3,(H,21,23)/b4-3+ |
| InChIKey | VFGDQIKEZZSNGO-ONEGZZNKSA-N |
| XLogP | 2.55 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|