C11H9NO6 — CID 86018632
methyl 3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 86018632) has the molecular formula C11H9NO6 and a molecular weight of 251.19 g/mol. Its IUPAC name is methyl 3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | methyl 3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 86018632 |
| Molecular Formula | C11H9NO6 |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | methyl 3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | COC(=O)C=Cc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C11H9NO6/c1-16-11(13)3-2-7-4-9-10(18-6-17-9)5-8(7)12(14)15/h2-5H,6H2,1H3 |
| InChIKey | TXYOYNRLFGCFCS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|