C19H15NO8 — CID 7716466
methyl 4-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]oxymethyl]benzoate (PubChem CID 7716466) has the molecular formula C19H15NO8 and a molecular weight of 385.33 g/mol. Its IUPAC name is methyl 4-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]oxymethyl]benzoate.
| Compound Name | methyl 4-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 7716466 |
| Molecular Formula | C19H15NO8 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | methyl 4-[[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(COC(=O)/C=C/c2cc3c(cc2[N+](=O)[O-])OCO3)cc1 |
| InChI | InChI=1S/C19H15NO8/c1-25-19(22)13-4-2-12(3-5-13)10-26-18(21)7-6-14-8-16-17(28-11-27-16)9-15(14)20(23)24/h2-9H,10-11H2,1H3/b7-6+ |
| InChIKey | RBIFPTWAPMPNPV-VOTSOKGWSA-N |
| XLogP | 2.87 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|