C15H16N2O7 — CID 7716570
[2-oxo-2-(propylamino)ethyl] (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 7716570) has the molecular formula C15H16N2O7 and a molecular weight of 336.30 g/mol. Its IUPAC name is [2-oxo-2-(propylamino)ethyl] (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(propylamino)ethyl] (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7716570 |
| Molecular Formula | C15H16N2O7 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | [2-oxo-2-(propylamino)ethyl] (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | CCCNC(=O)COC(=O)/C=C/c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C15H16N2O7/c1-2-5-16-14(18)8-22-15(19)4-3-10-6-12-13(24-9-23-12)7-11(10)17(20)21/h3-4,6-7H,2,5,8-9H2,1H3,(H,16,18)/b4-3+ |
| InChIKey | UPOHHIQLOJMJRV-ONEGZZNKSA-N |
| XLogP | 1.41 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|