C17H19N3O7 — CID 36860966
ethyl 4-[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]piperazine-1-carboxylate (PubChem CID 36860966) has the molecular formula C17H19N3O7 and a molecular weight of 377.35 g/mol. Its IUPAC name is ethyl 4-[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 36860966 |
| Molecular Formula | C17H19N3O7 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | ethyl 4-[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)/C=C/c2cc3c(cc2[N+](=O)[O-])OCO3)CC1 |
| InChI | InChI=1S/C17H19N3O7/c1-2-25-17(22)19-7-5-18(6-8-19)16(21)4-3-12-9-14-15(27-11-26-14)10-13(12)20(23)24/h3-4,9-10H,2,5-8,11H2,1H3/b4-3+ |
| InChIKey | IQDDVAJFMSHADP-ONEGZZNKSA-N |
| XLogP | 1.64 |
| TPSA | 111.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|