C20H21N4O5+ — CID 9226605
(E)-3-(6-nitro-1,3-benzodioxol-5-yl)-1-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one (PubChem CID 9226605) has the molecular formula C20H21N4O5+ and a molecular weight of 397.41 g/mol. Its IUPAC name is (E)-3-(6-nitro-1,3-benzodioxol-5-yl)-1-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(6-nitro-1,3-benzodioxol-5-yl)-1-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 9226605 |
| Molecular Formula | C20H21N4O5+ |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (E)-3-(6-nitro-1,3-benzodioxol-5-yl)-1-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc2c(cc1[N+](=O)[O-])OCO2)N1CC[NH+](Cc2ccncc2)CC1 |
| InChI | InChI=1S/C20H20N4O5/c25-20(23-9-7-22(8-10-23)13-15-3-5-21-6-4-15)2-1-16-11-18-19(29-14-28-18)12-17(16)24(26)27/h1-6,11-12H,7-10,13-14H2/p+1/b2-1+ |
| InChIKey | CNMQNSHNMJYAEG-OWOJBTEDSA-O |
| XLogP | 0.66 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|