C19H21ClN3O+ — CID 9226079
(E)-3-(3-chlorophenyl)-1-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one (PubChem CID 9226079) has the molecular formula C19H21ClN3O+ and a molecular weight of 342.85 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-1-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-chlorophenyl)-1-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 9226079 |
| Molecular Formula | C19H21ClN3O+ |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-1-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)N1CC[NH+](Cc2ccncc2)CC1 |
| InChI | InChI=1S/C19H20ClN3O/c20-18-3-1-2-16(14-18)4-5-19(24)23-12-10-22(11-13-23)15-17-6-8-21-9-7-17/h1-9,14H,10-13,15H2/p+1/b5-4+ |
| InChIKey | VRHGBWTZWPFRSH-SNAWJCMRSA-O |
| XLogP | 1.68 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|