C23H28N3O3+ — CID 9226385
(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-1-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one (PubChem CID 9226385) has the molecular formula C23H28N3O3+ and a molecular weight of 394.50 g/mol. Its IUPAC name is (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-1-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-1-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 9226385 |
| Molecular Formula | C23H28N3O3+ |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-1-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one |
| SMILES | C=CCOc1ccc(/C=C/C(=O)N2CC[NH+](Cc3ccncc3)CC2)cc1OC |
| InChI | InChI=1S/C23H27N3O3/c1-3-16-29-21-6-4-19(17-22(21)28-2)5-7-23(27)26-14-12-25(13-15-26)18-20-8-10-24-11-9-20/h3-11,17H,1,12-16,18H2,2H3/p+1/b7-5+ |
| InChIKey | RWJJPWSCIUPKSC-FNORWQNLSA-O |
| XLogP | 1.60 |
| TPSA | 56.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|