C19H22FN2O2S+ — CID 9181743
(E)-3-(3-fluoro-4-methoxyphenyl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one (PubChem CID 9181743) has the molecular formula C19H22FN2O2S+ and a molecular weight of 361.46 g/mol. Its IUPAC name is (E)-3-(3-fluoro-4-methoxyphenyl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-fluoro-4-methoxyphenyl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 9181743 |
| Molecular Formula | C19H22FN2O2S+ |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (E)-3-(3-fluoro-4-methoxyphenyl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)N2CC[NH+](Cc3ccsc3)CC2)cc1F |
| InChI | InChI=1S/C19H21FN2O2S/c1-24-18-4-2-15(12-17(18)20)3-5-19(23)22-9-7-21(8-10-22)13-16-6-11-25-14-16/h2-6,11-12,14H,7-10,13H2,1H3/p+1/b5-3+ |
| InChIKey | BGSYQZXUZQZGPL-HWKANZROSA-O |
| XLogP | 1.84 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|