C23H27FN2O3 — CID 55526801
(E)-3-(3-fluoro-4-methoxyphenyl)-1-[4-[(4-methoxyphenyl)methyl]-1,4-diazepan-1-yl]prop-2-en-1-one (PubChem CID 55526801) has the molecular formula C23H27FN2O3 and a molecular weight of 398.48 g/mol. Its IUPAC name is (E)-3-(3-fluoro-4-methoxyphenyl)-1-[4-[(4-methoxyphenyl)methyl]-1,4-diazepan-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-fluoro-4-methoxyphenyl)-1-[4-[(4-methoxyphenyl)methyl]-1,4-diazepan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 55526801 |
| Molecular Formula | C23H27FN2O3 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (E)-3-(3-fluoro-4-methoxyphenyl)-1-[4-[(4-methoxyphenyl)methyl]-1,4-diazepan-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(CN2CCCN(C(=O)/C=C/c3ccc(OC)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C23H27FN2O3/c1-28-20-8-4-19(5-9-20)17-25-12-3-13-26(15-14-25)23(27)11-7-18-6-10-22(29-2)21(24)16-18/h4-11,16H,3,12-15,17H2,1-2H3/b11-7+ |
| InChIKey | KLMYRILLCUGPNG-YRNVUSSQSA-N |
| XLogP | 3.59 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|